C25H26N6O3S — CID 162317828
CID 162317828 (PubChem CID 162317828) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol.
| Compound Name | CID 162317828 |
|---|---|
| PubChem CID | 162317828 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | — |
| SMILES | CN(C)CCOc1ccc(-c2cnc3c(-c4ccc([SH+](N)=O)c5ccccc45)cnn3c2)cn1.[OH-] |
| InChI | InChI=1S/C25H24N6O2S.H2O/c1-30(2)11-12-33-24-10-7-17(13-27-24)18-14-28-25-22(15-29-31(25)16-18)20-8-9-23(34(26)32)21-6-4-3-5-19(20)21;/h3-10,13-16H,11-12H2,1-2H3,(H2,26,32);1H2 |
| InChIKey | TZCXYSSZAHPBRI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|