C27H28N6O2S — CID 163291553
3-[[5-[3-[4-(methoxyamino)sulfanylnaphthalen-1-yl]pyrazolo[1,5-a]pyrimidin-6-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 163291553) has the molecular formula C27H28N6O2S and a molecular weight of 500.63 g/mol. Its IUPAC name is 3-[[5-[3-[4-(methoxyamino)sulfanylnaphthalen-1-yl]pyrazolo[1,5-a]pyrimidin-6-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-[3-[4-(methoxyamino)sulfanylnaphthalen-1-yl]pyrazolo[1,5-a]pyrimidin-6-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 163291553 |
| Molecular Formula | C27H28N6O2S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 3-[[5-[3-[4-(methoxyamino)sulfanylnaphthalen-1-yl]pyrazolo[1,5-a]pyrimidin-6-yl]-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CONSc1ccc(-c2cnn3cc(-c4ccc(OCCCN(C)C)nc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C27H28N6O2S/c1-32(2)13-6-14-35-26-12-9-19(15-28-26)20-16-29-27-24(17-30-33(27)18-20)22-10-11-25(36-31-34-3)23-8-5-4-7-21(22)23/h4-5,7-12,15-18,31H,6,13-14H2,1-3H3 |
| InChIKey | GYEUVPHBSITXAX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|