C31H33N5O4S — CID 162309407
CID 162309407 (PubChem CID 162309407) has the molecular formula C31H33N5O4S and a molecular weight of 571.70 g/mol.
| Compound Name | CID 162309407 |
|---|---|
| PubChem CID | 162309407 |
| Molecular Formula | C31H33N5O4S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | — |
| SMILES | N.O=[SH+]([O-])c1ccc(-c2cnn3cc(-c4ccc(OC5(CN6CCCCC6)COC5)cc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C31H30N4O4S.H3N/c36-40(37)29-13-12-26(25-6-2-3-7-27(25)29)28-17-33-35-18-23(16-32-30(28)35)22-8-10-24(11-9-22)39-31(20-38-21-31)19-34-14-4-1-5-15-34;/h2-3,6-13,16-18,40H,1,4-5,14-15,19-21H2;1H3 |
| InChIKey | PZGXXVJTNMBKGN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|