C31H29N4O4S- — CID 130214312
4-[6-[4-[3-(piperidin-1-ylmethyl)oxetan-3-yl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate (PubChem CID 130214312) has the molecular formula C31H29N4O4S- and a molecular weight of 553.66 g/mol. Its IUPAC name is 4-[6-[4-[3-(piperidin-1-ylmethyl)oxetan-3-yl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate.
| Compound Name | 4-[6-[4-[3-(piperidin-1-ylmethyl)oxetan-3-yl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate |
|---|---|
| PubChem CID | 130214312 |
| Molecular Formula | C31H29N4O4S- |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 4-[6-[4-[3-(piperidin-1-ylmethyl)oxetan-3-yl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate |
| SMILES | O=S([O-])c1ccc(-c2cnn3cc(-c4ccc(OC5(CN6CCCCC6)COC5)cc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C31H30N4O4S/c36-40(37)29-13-12-26(25-6-2-3-7-27(25)29)28-17-33-35-18-23(16-32-30(28)35)22-8-10-24(11-9-22)39-31(20-38-21-31)19-34-14-4-1-5-15-34/h2-3,6-13,16-18H,1,4-5,14-15,19-21H2,(H,36,37)/p-1 |
| InChIKey | JAAYIUJMMWGUPQ-UHFFFAOYSA-M |
| XLogP | 5.09 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|