C27H23N4O3S- — CID 130214308
4-[6-[4-(4-hydroxypiperidin-4-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate (PubChem CID 130214308) has the molecular formula C27H23N4O3S- and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-[6-[4-(4-hydroxypiperidin-4-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate.
| Compound Name | 4-[6-[4-(4-hydroxypiperidin-4-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate |
|---|---|
| PubChem CID | 130214308 |
| Molecular Formula | C27H23N4O3S- |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 4-[6-[4-(4-hydroxypiperidin-4-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate |
| SMILES | O=S([O-])c1ccc(-c2cnn3cc(-c4ccc(C5(O)CCNCC5)cc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C27H24N4O3S/c32-27(11-13-28-14-12-27)20-7-5-18(6-8-20)19-15-29-26-24(16-30-31(26)17-19)22-9-10-25(35(33)34)23-4-2-1-3-21(22)23/h1-10,15-17,28,32H,11-14H2,(H,33,34)/p-1 |
| InChIKey | UWPBNTHQDISOCI-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|