C27H32N5O2S+ — CID 145001795
CID 145001795 (PubChem CID 145001795) has the molecular formula C27H32N5O2S+ and a molecular weight of 490.65 g/mol.
| Compound Name | CID 145001795 |
|---|---|
| PubChem CID | 145001795 |
| Molecular Formula | C27H32N5O2S+ |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | — |
| SMILES | CC(C)[S+](=O)(O)c1cccc(-c2cnn3cc(-c4ccc(N5[C@H](C)CNC[C@@H]5C)cc4)cnc23)c1 |
| InChI | InChI=1S/C27H31N5O2S/c1-18(2)35(33,34)25-7-5-6-22(12-25)26-16-30-31-17-23(15-29-27(26)31)21-8-10-24(11-9-21)32-19(3)13-28-14-20(32)4/h5-12,15-20,28H,13-14H2,1-4H3/p+1/t19-,20+ |
| InChIKey | IBCLLOGWOZYLNF-BGYRXZFFSA-O |
| XLogP | 4.99 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|