C12H17NO5 — CID 163542775
(4S,6S)-2-methyl-6-(2-nitrocyclohexa-2,4-dien-1-yl)oxyoxan-4-ol (PubChem CID 163542775) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (4S,6S)-2-methyl-6-(2-nitrocyclohexa-2,4-dien-1-yl)oxyoxan-4-ol.
| Compound Name | (4S,6S)-2-methyl-6-(2-nitrocyclohexa-2,4-dien-1-yl)oxyoxan-4-ol |
|---|---|
| PubChem CID | 163542775 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (4S,6S)-2-methyl-6-(2-nitrocyclohexa-2,4-dien-1-yl)oxyoxan-4-ol |
| SMILES | CC1C[C@H](O)C[C@H](OC2CC=CC=C2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H17NO5/c1-8-6-9(14)7-12(17-8)18-11-5-3-2-4-10(11)13(15)16/h2-4,8-9,11-12,14H,5-7H2,1H3/t8?,9-,11?,12-/m0/s1 |
| InChIKey | FCNMWYCQILXJAN-FUCVQLFNSA-N |
| XLogP | 1.38 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|