C14H24O3 — CID 161042767
(2R,4S,6S)-2-methyl-6-(2-methylcyclohept-2-en-1-yl)oxyoxan-4-ol (PubChem CID 161042767) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2R,4S,6S)-2-methyl-6-(2-methylcyclohept-2-en-1-yl)oxyoxan-4-ol.
| Compound Name | (2R,4S,6S)-2-methyl-6-(2-methylcyclohept-2-en-1-yl)oxyoxan-4-ol |
|---|---|
| PubChem CID | 161042767 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2R,4S,6S)-2-methyl-6-(2-methylcyclohept-2-en-1-yl)oxyoxan-4-ol |
| SMILES | CC1=CCCCCC1O[C@H]1C[C@@H](O)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H24O3/c1-10-6-4-3-5-7-13(10)17-14-9-12(15)8-11(2)16-14/h6,11-15H,3-5,7-9H2,1-2H3/t11-,12+,13?,14+/m1/s1 |
| InChIKey | UBCCSQDEBBAAJQ-UDRMKVCMSA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|