C28H36N6O3S — CID 163543103
(1S,2R,3S)-1-[[2-[(1-cyclopropylcyclopropyl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-(1-hydroxycyclopentyl)cyclopentane-1,2-diol (PubChem CID 163543103) has the molecular formula C28H36N6O3S and a molecular weight of 536.70 g/mol. Its IUPAC name is (1S,2R,3S)-1-[[2-[(1-cyclopropylcyclopropyl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-(1-hydroxycyclopentyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S)-1-[[2-[(1-cyclopropylcyclopropyl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-(1-hydroxycyclopentyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 163543103 |
| Molecular Formula | C28H36N6O3S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (1S,2R,3S)-1-[[2-[(1-cyclopropylcyclopropyl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-(1-hydroxycyclopentyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NC2(C3CC3)CC2)nc(N[C@]2(O)CC[C@H](C3(O)CCCC3)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C28H36N6O3S/c1-15-20(24-31-21-16(2)29-14-8-19(21)38-24)23(32-25(30-15)34-26(12-13-26)17-5-6-17)33-28(37)11-7-18(22(28)35)27(36)9-3-4-10-27/h8,14,17-18,22,35-37H,3-7,9-13H2,1-2H3,(H2,30,32,33,34)/t18-,22+,28-/m0/s1 |
| InChIKey | FCTRVGLMKKAZQU-CTFOTTMXSA-N |
| XLogP | 4.30 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|