C13H23N3 — CID 163547052
N-ethyl-4-(ethyldiazenyl)-N-propylcyclohexa-2,4-dien-1-amine (PubChem CID 163547052) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N-ethyl-4-(ethyldiazenyl)-N-propylcyclohexa-2,4-dien-1-amine.
| Compound Name | N-ethyl-4-(ethyldiazenyl)-N-propylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 163547052 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N-ethyl-4-(ethyldiazenyl)-N-propylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCN(CC)C1C=CC(/N=N/CC)=CC1 |
| InChI | InChI=1S/C13H23N3/c1-4-11-16(6-3)13-9-7-12(8-10-13)15-14-5-2/h7-9,13H,4-6,10-11H2,1-3H3/b15-14+ |
| InChIKey | FFXPQNUYAYFIRJ-CCEZHUSRSA-N |
| XLogP | 3.40 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|