C10H15FN2O — CID 163548018
4-fluoro-3-morpholin-4-ylcyclohexa-2,4-dien-1-amine (PubChem CID 163548018) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 4-fluoro-3-morpholin-4-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-fluoro-3-morpholin-4-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 163548018 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-fluoro-3-morpholin-4-ylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=C(N2CCOCC2)C(F)=CC1 |
| InChI | InChI=1S/C10H15FN2O/c11-9-2-1-8(12)7-10(9)13-3-5-14-6-4-13/h2,7-8H,1,3-6,12H2 |
| InChIKey | FGSDZNQRBSAJOQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |