C16H12F5I — CID 163549667
1,3-difluoro-5-[2-[4-iodo-3-(trifluoromethyl)phenyl]ethyl]-2-methylbenzene (PubChem CID 163549667) has the molecular formula C16H12F5I and a molecular weight of 426.17 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-iodo-3-(trifluoromethyl)phenyl]ethyl]-2-methylbenzene.
| Compound Name | 1,3-difluoro-5-[2-[4-iodo-3-(trifluoromethyl)phenyl]ethyl]-2-methylbenzene |
|---|---|
| PubChem CID | 163549667 |
| Molecular Formula | C16H12F5I |
| Molecular Weight | 426.17 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-iodo-3-(trifluoromethyl)phenyl]ethyl]-2-methylbenzene |
| SMILES | Cc1c(F)cc(CCc2ccc(I)c(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C16H12F5I/c1-9-13(17)7-11(8-14(9)18)3-2-10-4-5-15(22)12(6-10)16(19,20)21/h4-8H,2-3H2,1H3 |
| InChIKey | FHZZISJQSXEMKS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.17 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|