C24H27NO4S — CID 163549740
[5-hydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrothiochromen-7-yl)oxy]hexyl] prop-2-enimidate (PubChem CID 163549740) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is [5-hydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrothiochromen-7-yl)oxy]hexyl] prop-2-enimidate.
| Compound Name | [5-hydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrothiochromen-7-yl)oxy]hexyl] prop-2-enimidate |
|---|---|
| PubChem CID | 163549740 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [5-hydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrothiochromen-7-yl)oxy]hexyl] prop-2-enimidate |
| SMILES | [H]/N=C(\C=C)OCCCCC(O)COC1=CC2SC(=O)C(c3ccccc3)=CC2C=C1 |
| InChI | InChI=1S/C24H27NO4S/c1-2-23(25)28-13-7-6-10-19(26)16-29-20-12-11-18-14-21(17-8-4-3-5-9-17)24(27)30-22(18)15-20/h2-5,8-9,11-12,14-15,18-19,22,25-26H,1,6-7,10,13,16H2/b25-23+ |
| InChIKey | FIBIVMPNEUIHBJ-WJTDDFOZSA-N |
| XLogP | 4.51 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|