C29H38O7 — CID 126604927
3-[4-(3,4-dihydroxyhexoxy)phenyl]-7-(2-hydroxy-6-methylhept-6-enoxy)-4a,8a-dihydrochromen-2-one (PubChem CID 126604927) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-[4-(3,4-dihydroxyhexoxy)phenyl]-7-(2-hydroxy-6-methylhept-6-enoxy)-4a,8a-dihydrochromen-2-one.
| Compound Name | 3-[4-(3,4-dihydroxyhexoxy)phenyl]-7-(2-hydroxy-6-methylhept-6-enoxy)-4a,8a-dihydrochromen-2-one |
|---|---|
| PubChem CID | 126604927 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[4-(3,4-dihydroxyhexoxy)phenyl]-7-(2-hydroxy-6-methylhept-6-enoxy)-4a,8a-dihydrochromen-2-one |
| SMILES | C=C(C)CCCC(O)COC1=CC2OC(=O)C(c3ccc(OCCC(O)C(O)CC)cc3)=CC2C=C1 |
| InChI | InChI=1S/C29H38O7/c1-4-26(31)27(32)14-15-34-23-11-8-20(9-12-23)25-16-21-10-13-24(17-28(21)36-29(25)33)35-18-22(30)7-5-6-19(2)3/h8-13,16-17,21-22,26-28,30-32H,2,4-7,14-15,18H2,1,3H3 |
| InChIKey | DMVXQNRHZYJXOV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|