C25H28O7 — CID 126604902
[3,4-dihydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrochromen-7-yl)oxy]hexyl] 2-methylprop-2-enoate (PubChem CID 126604902) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is [3,4-dihydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrochromen-7-yl)oxy]hexyl] 2-methylprop-2-enoate.
| Compound Name | [3,4-dihydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrochromen-7-yl)oxy]hexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126604902 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [3,4-dihydroxy-6-[(2-oxo-3-phenyl-4a,8a-dihydrochromen-7-yl)oxy]hexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(O)C(O)CCOC1=CC2OC(=O)C(c3ccccc3)=CC2C=C1 |
| InChI | InChI=1S/C25H28O7/c1-16(2)24(28)31-13-11-22(27)21(26)10-12-30-19-9-8-18-14-20(17-6-4-3-5-7-17)25(29)32-23(18)15-19/h3-9,14-15,18,21-23,26-27H,1,10-13H2,2H3 |
| InChIKey | AXYGVBIFQPXBSA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|