C25H30O7 — CID 145263373
[6-[(3-cyclohexa-1,5-dien-1-yl-2-oxo-4a,8a-dihydrochromen-7-yl)oxy]-3,4-dihydroxyhexyl] 2-methylprop-2-enoate (PubChem CID 145263373) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is [6-[(3-cyclohexa-1,5-dien-1-yl-2-oxo-4a,8a-dihydrochromen-7-yl)oxy]-3,4-dihydroxyhexyl] 2-methylprop-2-enoate.
| Compound Name | [6-[(3-cyclohexa-1,5-dien-1-yl-2-oxo-4a,8a-dihydrochromen-7-yl)oxy]-3,4-dihydroxyhexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145263373 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [6-[(3-cyclohexa-1,5-dien-1-yl-2-oxo-4a,8a-dihydrochromen-7-yl)oxy]-3,4-dihydroxyhexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(O)C(O)CCOC1=CC2OC(=O)C(C3=CCCC=C3)=CC2C=C1 |
| InChI | InChI=1S/C25H30O7/c1-16(2)24(28)31-13-11-22(27)21(26)10-12-30-19-9-8-18-14-20(17-6-4-3-5-7-17)25(29)32-23(18)15-19/h4,6-9,14-15,18,21-23,26-27H,1,3,5,10-13H2,2H3 |
| InChIKey | YHQMRXVSBYJAQF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|