C22H29N3O2 — CID 163550043
N-hydroxy-3-[(6S)-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-bicyclo[4.1.0]hept-4-enyl]propanamide (PubChem CID 163550043) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-hydroxy-3-[(6S)-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-bicyclo[4.1.0]hept-4-enyl]propanamide.
| Compound Name | N-hydroxy-3-[(6S)-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-bicyclo[4.1.0]hept-4-enyl]propanamide |
|---|---|
| PubChem CID | 163550043 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-hydroxy-3-[(6S)-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-bicyclo[4.1.0]hept-4-enyl]propanamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNCC1=CCC(CCC(=O)NO)C2C[C@H]12 |
| InChI | InChI=1S/C22H29N3O2/c1-14-17(18-4-2-3-5-21(18)24-14)10-11-23-13-16-7-6-15(19-12-20(16)19)8-9-22(26)25-27/h2-5,7,15,19-20,23-24,27H,6,8-13H2,1H3,(H,25,26)/t15?,19?,20-/m1/s1 |
| InChIKey | FIHQDGQHRRDJGA-RGKRWLCDSA-N |
| XLogP | 3.48 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|