C23H29N3O2 — CID 143411704
N-hydroxy-3-[4-[[2-(2-propan-2-yl-1H-indol-3-yl)ethylamino]methyl]phenyl]propanamide (PubChem CID 143411704) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-hydroxy-3-[4-[[2-(2-propan-2-yl-1H-indol-3-yl)ethylamino]methyl]phenyl]propanamide.
| Compound Name | N-hydroxy-3-[4-[[2-(2-propan-2-yl-1H-indol-3-yl)ethylamino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 143411704 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-hydroxy-3-[4-[[2-(2-propan-2-yl-1H-indol-3-yl)ethylamino]methyl]phenyl]propanamide |
| SMILES | CC(C)c1[nH]c2ccccc2c1CCNCc1ccc(CCC(=O)NO)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-16(2)23-20(19-5-3-4-6-21(19)25-23)13-14-24-15-18-9-7-17(8-10-18)11-12-22(27)26-28/h3-10,16,24-25,28H,11-15H2,1-2H3,(H,26,27) |
| InChIKey | VCLBXQLMVNHEKA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|