C19H17F3N2O4S — CID 163551372
2-(4-nitro-2,3-dihydro-1H-inden-1-yl)-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepine 1,1-dioxide (PubChem CID 163551372) has the molecular formula C19H17F3N2O4S and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-(4-nitro-2,3-dihydro-1H-inden-1-yl)-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepine 1,1-dioxide.
| Compound Name | 2-(4-nitro-2,3-dihydro-1H-inden-1-yl)-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 163551372 |
| Molecular Formula | C19H17F3N2O4S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-(4-nitro-2,3-dihydro-1H-inden-1-yl)-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepine 1,1-dioxide |
| SMILES | O=[N+]([O-])c1cccc2c1CCC2N1CCCc2ccc(C(F)(F)F)cc2S1(=O)=O |
| InChI | InChI=1S/C19H17F3N2O4S/c20-19(21,22)13-7-6-12-3-2-10-23(29(27,28)18(12)11-13)16-9-8-15-14(16)4-1-5-17(15)24(25)26/h1,4-7,11,16H,2-3,8-10H2 |
| InChIKey | FJIIZVFRJTZQAG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|