C18H17F3N2O2 — CID 67291102
4,4-dimethyl-2-(2-nitrophenyl)-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline (PubChem CID 67291102) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2-nitrophenyl)-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline.
| Compound Name | 4,4-dimethyl-2-(2-nitrophenyl)-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 67291102 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4,4-dimethyl-2-(2-nitrophenyl)-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline |
| SMILES | CC1(C)CC(c2ccccc2[N+](=O)[O-])Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H17F3N2O2/c1-17(2)10-15(12-5-3-4-6-16(12)23(24)25)22-14-8-7-11(9-13(14)17)18(19,20)21/h3-9,15,22H,10H2,1-2H3 |
| InChIKey | BURFLUKQAPGHQW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|