C30H36N5O9S+ — CID 163551792
[4,7-bis(dimethylamino)-9-[[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium (PubChem CID 163551792) has the molecular formula C30H36N5O9S+ and a molecular weight of 642.71 g/mol. Its IUPAC name is [4,7-bis(dimethylamino)-9-[[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium.
| Compound Name | [4,7-bis(dimethylamino)-9-[[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium |
|---|---|
| PubChem CID | 163551792 |
| Molecular Formula | C30H36N5O9S+ |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | [4,7-bis(dimethylamino)-9-[[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium |
| SMILES | CCOC(=O)c1csc(NCc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C([NH3+])=O)C(=O)C(N(C)C)C4CC2C3)n1 |
| InChI | InChI=1S/C30H35N5O9S/c1-6-44-28(42)16-11-45-29(33-16)32-10-13-9-17(34(2)3)14-7-12-8-15-21(35(4)5)24(38)20(27(31)41)26(40)30(15,43)25(39)18(12)23(37)19(14)22(13)36/h9,11-12,15,21,36-37,40,43H,6-8,10H2,1-5H3,(H2,31,41)(H,32,33)/p+1 |
| InChIKey | DDXNTLSOKSHEPY-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 217.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|