C20H23NO — CID 163552779
(3aR,9bS)-2-benzyl-3a,6-dimethyl-1,3,5,9b-tetrahydroisochromeno[3,4-c]pyrrole (PubChem CID 163552779) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (3aR,9bS)-2-benzyl-3a,6-dimethyl-1,3,5,9b-tetrahydroisochromeno[3,4-c]pyrrole.
| Compound Name | (3aR,9bS)-2-benzyl-3a,6-dimethyl-1,3,5,9b-tetrahydroisochromeno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 163552779 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3aR,9bS)-2-benzyl-3a,6-dimethyl-1,3,5,9b-tetrahydroisochromeno[3,4-c]pyrrole |
| SMILES | Cc1cccc2c1CO[C@@]1(C)CN(Cc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C20H23NO/c1-15-7-6-10-17-18(15)13-22-20(2)14-21(12-19(17)20)11-16-8-4-3-5-9-16/h3-10,19H,11-14H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | FKLGGIIQLVGVQS-UXHICEINSA-N |
| XLogP | 3.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |