C9H20N2O4 — CID 163553522
1-(2-hydroxy-3-methoxypropyl)-1-(3-methoxypropyl)urea (PubChem CID 163553522) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methoxypropyl)-1-(3-methoxypropyl)urea.
| Compound Name | 1-(2-hydroxy-3-methoxypropyl)-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 163553522 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1-(2-hydroxy-3-methoxypropyl)-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(CC(O)COC)C(N)=O |
| InChI | InChI=1S/C9H20N2O4/c1-14-5-3-4-11(9(10)13)6-8(12)7-15-2/h8,12H,3-7H2,1-2H3,(H2,10,13) |
| InChIKey | FLCKVIBJUBDHAX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|