C22H27NOS — CID 163554515
N-methyl-3-[4-(3-methylcyclopropen-1-yl)butyl]-4-(4-methylsulfanylphenoxy)aniline (PubChem CID 163554515) has the molecular formula C22H27NOS and a molecular weight of 353.53 g/mol. Its IUPAC name is N-methyl-3-[4-(3-methylcyclopropen-1-yl)butyl]-4-(4-methylsulfanylphenoxy)aniline.
| Compound Name | N-methyl-3-[4-(3-methylcyclopropen-1-yl)butyl]-4-(4-methylsulfanylphenoxy)aniline |
|---|---|
| PubChem CID | 163554515 |
| Molecular Formula | C22H27NOS |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-methyl-3-[4-(3-methylcyclopropen-1-yl)butyl]-4-(4-methylsulfanylphenoxy)aniline |
| SMILES | CNc1ccc(Oc2ccc(SC)cc2)c(CCCCC2=CC2C)c1 |
| InChI | InChI=1S/C22H27NOS/c1-16-14-17(16)6-4-5-7-18-15-19(23-2)8-13-22(18)24-20-9-11-21(25-3)12-10-20/h8-16,23H,4-7H2,1-3H3 |
| InChIKey | FLWLNPSQLYYHNN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|