C9H16O2 — CID 163555008
(2S,4S)-4-methoxy-2,4-dimethyl-6-methylideneoxane (PubChem CID 163555008) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2S,4S)-4-methoxy-2,4-dimethyl-6-methylideneoxane.
| Compound Name | (2S,4S)-4-methoxy-2,4-dimethyl-6-methylideneoxane |
|---|---|
| PubChem CID | 163555008 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2S,4S)-4-methoxy-2,4-dimethyl-6-methylideneoxane |
| SMILES | C=C1C[C@@](C)(OC)C[C@H](C)O1 |
| InChI | InChI=1S/C9H16O2/c1-7-5-9(3,10-4)6-8(2)11-7/h8H,1,5-6H2,2-4H3/t8-,9+/m0/s1 |
| InChIKey | FMGZYMZKASZVJH-DTWKUNHWSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |