C15H29N3O7 — CID 163556268
[2-(5-aminooxy-3-methyl-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate (PubChem CID 163556268) has the molecular formula C15H29N3O7 and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-(5-aminooxy-3-methyl-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate.
| Compound Name | [2-(5-aminooxy-3-methyl-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 163556268 |
| Molecular Formula | C15H29N3O7 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [2-(5-aminooxy-3-methyl-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC(=O)NCC)OCCC(C)C(=O)CON |
| InChI | InChI=1S/C15H29N3O7/c1-4-17-14(20)23-8-12(9-24-15(21)18-5-2)22-7-6-11(3)13(19)10-25-16/h11-12H,4-10,16H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | RJYJYHZOLQFXPL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|