C26H24IN5O2S — CID 163557906
N-[[3-[[2-(iodomethyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamoyl]phenyl]methyl]-5-(1H-pyrazol-4-yl)thiophene-2-carboxamide (PubChem CID 163557906) has the molecular formula C26H24IN5O2S and a molecular weight of 597.48 g/mol. Its IUPAC name is N-[[3-[[2-(iodomethyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamoyl]phenyl]methyl]-5-(1H-pyrazol-4-yl)thiophene-2-carboxamide.
| Compound Name | N-[[3-[[2-(iodomethyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamoyl]phenyl]methyl]-5-(1H-pyrazol-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 163557906 |
| Molecular Formula | C26H24IN5O2S |
| Molecular Weight | 597.48 g/mol |
| Exact Mass | 597.07 |
| IUPAC Name | N-[[3-[[2-(iodomethyl)-3,4-dihydro-1H-isoquinolin-7-yl]carbamoyl]phenyl]methyl]-5-(1H-pyrazol-4-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CN(CI)CC2)c1cccc(CNC(=O)c2ccc(-c3cn[nH]c3)s2)c1 |
| InChI | InChI=1S/C26H24IN5O2S/c27-16-32-9-8-18-4-5-22(11-20(18)15-32)31-25(33)19-3-1-2-17(10-19)12-28-26(34)24-7-6-23(35-24)21-13-29-30-14-21/h1-7,10-11,13-14H,8-9,12,15-16H2,(H,28,34)(H,29,30)(H,31,33) |
| InChIKey | FORKBQBQWHBPHJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|