C11H16N2 — CID 163562000
2-ethyl-3-methyl-1,4,4a,7-tetrahydro-1,8-naphthyridine (PubChem CID 163562000) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1,4,4a,7-tetrahydro-1,8-naphthyridine.
| Compound Name | 2-ethyl-3-methyl-1,4,4a,7-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 163562000 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-ethyl-3-methyl-1,4,4a,7-tetrahydro-1,8-naphthyridine |
| SMILES | CCC1=C(C)CC2C=CCN=C2N1 |
| InChI | InChI=1S/C11H16N2/c1-3-10-8(2)7-9-5-4-6-12-11(9)13-10/h4-5,9H,3,6-7H2,1-2H3,(H,12,13) |
| InChIKey | FRZQMKZVBLUIAM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|