C43H34N4 — CID 163562418
2-[4-[4-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 163562418) has the molecular formula C43H34N4 and a molecular weight of 606.77 g/mol. Its IUPAC name is 2-[4-[4-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 2-[4-[4-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 163562418 |
| Molecular Formula | C43H34N4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 2-[4-[4-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | C[C@@H]1C[C@@H]2CC[C@@H](C2)C12c1ccccc1-c1c(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5C#N)cc4)n3)cccc12 |
| InChI | InChI=1S/C43H34N4/c1-27-24-28-18-23-33(25-28)43(27)37-16-8-7-14-35(37)39-36(15-9-17-38(39)43)42-46-40(30-10-3-2-4-11-30)45-41(47-42)31-21-19-29(20-22-31)34-13-6-5-12-32(34)26-44/h2-17,19-22,27-28,33H,18,23-25H2,1H3/t27-,28+,33+,43?/m1/s1 |
| InChIKey | FSIXSJYRFGKIBG-FBJQFWFUSA-N |
| XLogP | 10.13 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |