C49H38N4 — CID 163859819
2-[3-[4-[3-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 163859819) has the molecular formula C49H38N4 and a molecular weight of 682.87 g/mol. Its IUPAC name is 2-[3-[4-[3-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 2-[3-[4-[3-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 163859819 |
| Molecular Formula | C49H38N4 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 2-[3-[4-[3-[(1S,3R,5S)-3-methylspiro[bicyclo[3.2.1]octane-2,9'-fluorene]-4'-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | C[C@@H]1C[C@@H]2CC[C@@H](C2)C12c1ccccc1-c1c(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6C#N)c5)n4)c3)cccc12 |
| InChI | InChI=1S/C49H38N4/c1-31-26-32-24-25-39(27-32)49(31)43-22-8-7-20-42(43)45-41(21-11-23-44(45)49)35-16-10-18-37(29-35)48-52-46(33-12-3-2-4-13-33)51-47(53-48)36-17-9-15-34(28-36)40-19-6-5-14-38(40)30-50/h2-23,28-29,31-32,39H,24-27H2,1H3/t31-,32+,39+,49?/m1/s1 |
| InChIKey | PBMSRKHIROFAGA-CEKOFSBNSA-N |
| XLogP | 11.80 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |