C42H40N4 — CID 174077906
5-[4-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9,9-dimethylfluorene-1-carbonitrile (PubChem CID 174077906) has the molecular formula C42H40N4 and a molecular weight of 600.81 g/mol. Its IUPAC name is 5-[4-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9,9-dimethylfluorene-1-carbonitrile.
| Compound Name | 5-[4-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9,9-dimethylfluorene-1-carbonitrile |
|---|---|
| PubChem CID | 174077906 |
| Molecular Formula | C42H40N4 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 5-[4-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9,9-dimethylfluorene-1-carbonitrile |
| SMILES | C[C@@H]1CC2C[C@H](C)CC(c3ccc(-c4nc(-c5ccccc5)nc(-c5cccc6c5-c5cccc(C#N)c5C6(C)C)n4)cc3)(C2)C1 |
| InChI | InChI=1S/C42H40N4/c1-26-20-28-21-27(2)23-42(22-26,24-28)32-18-16-30(17-19-32)39-44-38(29-10-6-5-7-11-29)45-40(46-39)34-14-9-15-35-36(34)33-13-8-12-31(25-43)37(33)41(35,3)4/h5-19,26-28H,20-24H2,1-4H3/t26-,27+,28?,42? |
| InChIKey | HSUGZHXZDTWATJ-PYNYDIDPSA-N |
| XLogP | 10.15 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |