C48H44N4 — CID 174077670
5-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]benzonitrile (PubChem CID 174077670) has the molecular formula C48H44N4 and a molecular weight of 676.91 g/mol. Its IUPAC name is 5-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]benzonitrile.
| Compound Name | 5-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]benzonitrile |
|---|---|
| PubChem CID | 174077670 |
| Molecular Formula | C48H44N4 |
| Molecular Weight | 676.91 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | 5-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]benzonitrile |
| SMILES | C[C@@H]1CC2C[C@H](C)CC(c3ccc(-c4ccc5c(c4)C(C)(C)c4cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc4-5)c(C#N)c3)(C2)C1 |
| InChI | InChI=1S/C48H44N4/c1-30-21-32-22-31(2)27-48(26-30,28-32)38-17-20-39(37(23-38)29-49)35-15-18-40-41-19-16-36(25-43(41)47(3,4)42(40)24-35)46-51-44(33-11-7-5-8-12-33)50-45(52-46)34-13-9-6-10-14-34/h5-20,23-25,30-32H,21-22,26-28H2,1-4H3/t30-,31+,32?,48? |
| InChIKey | UYMRFRRPUGCJHB-VUKFEAOASA-N |
| XLogP | 11.82 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.91 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |