C45H40N4 — CID 174078703
2-[5-[(3S,7R)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile (PubChem CID 174078703) has the molecular formula C45H40N4 and a molecular weight of 636.84 g/mol. Its IUPAC name is 2-[5-[(3S,7R)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 2-[5-[(3S,7R)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 174078703 |
| Molecular Formula | C45H40N4 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | 2-[5-[(3S,7R)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile |
| SMILES | C[C@@H]1CC2C[C@H](C)CC(c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c(-c4ccccc4C#N)c3)(C2)C1 |
| InChI | InChI=1S/C45H40N4/c1-30-23-32-24-31(2)27-45(26-30,28-32)38-21-22-40(41(25-38)39-16-10-9-15-37(39)29-46)33-17-19-36(20-18-33)44-48-42(34-11-5-3-6-12-34)47-43(49-44)35-13-7-4-8-14-35/h3-22,25,30-32H,23-24,26-28H2,1-2H3/t30-,31+,32?,45? |
| InChIKey | WZKVNCPGCKJXFB-CAGWRJSWSA-N |
| XLogP | 11.18 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |