About 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone
2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone (PubChem CID 163563150) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone.
Molecular Properties
| Compound Name | 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone |
| PubChem CID | 163563150 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone |
| SMILES | C=S(C)C(=O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NOS/c1-13(10-12(14)15(2)3)9-11-7-5-4-6-8-11/h4-8H,2,9-10H2,1,3H3 |
| InChIKey | FSYSHKHQXHJSEJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone?
The IUPAC name of 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone (CID 163563150) is 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone.
What is the SMILES notation for 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone?
The canonical SMILES for 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone is C=S(C)C(=O)CN(C)Cc1ccccc1.
What is the InChIKey of 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone?
The InChIKey is FSYSHKHQXHJSEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-13(10-12(14)15(2)3)9-11-7-5-4-6-8-11/h4-8H,2,9-10H2,1,3H3.
What are the key properties of 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone?
2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone has a molecular weight of 223.34 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl(methyl)amino]-1-[methyl(methylidene)-λ4-sulfanyl]ethanone is sourced from PubChem (CID 163563150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).