C15H21N3O3 — CID 163566238
tert-butyl (1R,5R)-3-formyl-5-(pyrazol-1-ylmethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 163566238) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl (1R,5R)-3-formyl-5-(pyrazol-1-ylmethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,5R)-3-formyl-5-(pyrazol-1-ylmethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 163566238 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl (1R,5R)-3-formyl-5-(pyrazol-1-ylmethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C=O)C[C@@]2(Cn3cccn3)C[C@@H]12 |
| InChI | InChI=1S/C15H21N3O3/c1-14(2,3)21-13(20)18-11(9-19)7-15(8-12(15)18)10-17-6-4-5-16-17/h4-6,9,11-12H,7-8,10H2,1-3H3/t11?,12-,15+/m1/s1 |
| InChIKey | FVKUFQNLWAWRHV-ZCADOIRISA-N |
| XLogP | 1.85 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|