C31H40O9 — CID 163569141
[(2S,4S,10R)-4-acetyloxy-1,9-dihydroxy-12-(hydroxymethyl)-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 163569141) has the molecular formula C31H40O9 and a molecular weight of 556.65 g/mol. Its IUPAC name is [(2S,4S,10R)-4-acetyloxy-1,9-dihydroxy-12-(hydroxymethyl)-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(2S,4S,10R)-4-acetyloxy-1,9-dihydroxy-12-(hydroxymethyl)-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 163569141 |
| Molecular Formula | C31H40O9 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | [(2S,4S,10R)-4-acetyloxy-1,9-dihydroxy-12-(hydroxymethyl)-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@@]12COC1CC(O)[C@]1(C)C(=O)C(C)(CO)C3=C(C)CCC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |
| InChI | InChI=1S/C31H40O9/c1-17-12-13-31(37)24(39-25(35)19-10-8-7-9-11-19)23-29(6,26(36)28(5,15-32)22(17)27(31,3)4)20(34)14-21-30(23,16-38-21)40-18(2)33/h7-11,20-21,23-24,32,34,37H,12-16H2,1-6H3/t20?,21?,23?,24?,28?,29-,30-,31?/m0/s1 |
| InChIKey | FXTAOMVBXWIDKZ-ZWPDFNRRSA-N |
| XLogP | 2.75 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|