About N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine
N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine (PubChem CID 163572007) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine.
Molecular Properties
| Compound Name | N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine |
| PubChem CID | 163572007 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine |
| SMILES | C=CC(N=C(C)C)C(=C)C |
| InChI | InChI=1S/C9H15N/c1-6-9(7(2)3)10-8(4)5/h6,9H,1-2H2,3-5H3 |
| InChIKey | GAEHEYWZRXCHQO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine?
The IUPAC name of N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine (CID 163572007) is N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine.
What is the SMILES notation for N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine?
The canonical SMILES for N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine is C=CC(N=C(C)C)C(=C)C.
What is the InChIKey of N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine?
The InChIKey is GAEHEYWZRXCHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-6-9(7(2)3)10-8(4)5/h6,9H,1-2H2,3-5H3.
What are the key properties of N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine?
N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine has a molecular weight of 137.23 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine is sourced from PubChem (CID 163572007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).