C9H15N — CID 163572007
N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine (PubChem CID 163572007) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine.
| Compound Name | N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine |
|---|---|
| PubChem CID | 163572007 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-(2-methylpenta-1,4-dien-3-yl)propan-2-imine |
| SMILES | C=CC(N=C(C)C)C(=C)C |
| InChI | InChI=1S/C9H15N/c1-6-9(7(2)3)10-8(4)5/h6,9H,1-2H2,3-5H3 |
| InChIKey | GAEHEYWZRXCHQO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|