C25H14Cl3F5N2O2 — CID 163576872
2-chloro-5-[[2,2-dichloro-3-[3-(trifluoromethyl)cyclohepta-1,3,5,6-tetraen-1-yl]cyclopropanecarbonyl]amino]-N-(2,6-difluorophenyl)benzamide (PubChem CID 163576872) has the molecular formula C25H14Cl3F5N2O2 and a molecular weight of 575.75 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-[3-(trifluoromethyl)cyclohepta-1,3,5,6-tetraen-1-yl]cyclopropanecarbonyl]amino]-N-(2,6-difluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-[3-(trifluoromethyl)cyclohepta-1,3,5,6-tetraen-1-yl]cyclopropanecarbonyl]amino]-N-(2,6-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 163576872 |
| Molecular Formula | C25H14Cl3F5N2O2 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 574.00 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-[3-(trifluoromethyl)cyclohepta-1,3,5,6-tetraen-1-yl]cyclopropanecarbonyl]amino]-N-(2,6-difluorophenyl)benzamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cc(NC(=O)C2C(C3=CC(C(F)(F)F)=CC=C=C3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C25H14Cl3F5N2O2/c26-16-9-8-14(11-15(16)22(36)35-21-17(29)6-3-7-18(21)30)34-23(37)20-19(24(20,27)28)12-4-1-2-5-13(10-12)25(31,32)33/h2-11,19-20H,(H,34,37)(H,35,36) |
| InChIKey | GEGDYLPHMHEJSY-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|