C17H18F3NO — CID 163579366
phenyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yloxy]methanamine (PubChem CID 163579366) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is phenyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yloxy]methanamine.
| Compound Name | phenyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yloxy]methanamine |
|---|---|
| PubChem CID | 163579366 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | phenyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yloxy]methanamine |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)OC(N)c1ccccc1 |
| InChI | InChI=1S/C17H18F3NO/c1-12(22-16(21)14-7-3-2-4-8-14)10-13-6-5-9-15(11-13)17(18,19)20/h2-9,11-12,16H,10,21H2,1H3 |
| InChIKey | GGFBNFZFVATSRZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|