C24H35N5O3 — CID 163582466
(2S,4S)-4-amino-1-[3,3-dimethyl-2-[2-(methylamino)prop-2-enoylamino]butanoyl]-N-(1-phenylpropylidene)pyrrolidine-2-carboxamide (PubChem CID 163582466) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is (2S,4S)-4-amino-1-[3,3-dimethyl-2-[2-(methylamino)prop-2-enoylamino]butanoyl]-N-(1-phenylpropylidene)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-1-[3,3-dimethyl-2-[2-(methylamino)prop-2-enoylamino]butanoyl]-N-(1-phenylpropylidene)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163582466 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (2S,4S)-4-amino-1-[3,3-dimethyl-2-[2-(methylamino)prop-2-enoylamino]butanoyl]-N-(1-phenylpropylidene)pyrrolidine-2-carboxamide |
| SMILES | C=C(NC)C(=O)NC(C(=O)N1C[C@@H](N)C[C@H]1C(=O)/N=C(\CC)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H35N5O3/c1-7-18(16-11-9-8-10-12-16)27-22(31)19-13-17(25)14-29(19)23(32)20(24(3,4)5)28-21(30)15(2)26-6/h8-12,17,19-20,26H,2,7,13-14,25H2,1,3-6H3,(H,28,30)/b27-18+/t17-,19-,20?/m0/s1 |
| InChIKey | GIRWHYZQEOJQDR-IAPHBBBQSA-N |
| XLogP | 1.60 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|