C29H37ClN4O7 — CID 163586485
tert-butyl N-[2-[(1S,2S,5R)-2-[(1-amino-1,2-dioxohept-6-en-3-yl)carbamoyl]-6-chloro-6-hydroxy-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate (PubChem CID 163586485) has the molecular formula C29H37ClN4O7 and a molecular weight of 589.09 g/mol. Its IUPAC name is tert-butyl N-[2-[(1S,2S,5R)-2-[(1-amino-1,2-dioxohept-6-en-3-yl)carbamoyl]-6-chloro-6-hydroxy-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1S,2S,5R)-2-[(1-amino-1,2-dioxohept-6-en-3-yl)carbamoyl]-6-chloro-6-hydroxy-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 163586485 |
| Molecular Formula | C29H37ClN4O7 |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | tert-butyl N-[2-[(1S,2S,5R)-2-[(1-amino-1,2-dioxohept-6-en-3-yl)carbamoyl]-6-chloro-6-hydroxy-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate |
| SMILES | C=CCCC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)C(NC(=O)OC(C)(C)C)C1Cc3ccccc3C1)C2(O)Cl)C(=O)C(N)=O |
| InChI | InChI=1S/C29H37ClN4O7/c1-5-6-11-19(23(35)24(31)36)32-25(37)22-20-18(29(20,30)40)14-34(22)26(38)21(33-27(39)41-28(2,3)4)17-12-15-9-7-8-10-16(15)13-17/h5,7-10,17-22,40H,1,6,11-14H2,2-4H3,(H2,31,36)(H,32,37)(H,33,39)/t18-,19?,20-,21?,22-,29?/m0/s1 |
| InChIKey | GLXVEEGVNRVOMV-RXNQUMFNSA-N |
| XLogP | 1.18 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|