C30H23FN4O4 — CID 163587065
3-amino-N-[4-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-2-phenylmethoxybenzamide (PubChem CID 163587065) has the molecular formula C30H23FN4O4 and a molecular weight of 522.54 g/mol. Its IUPAC name is 3-amino-N-[4-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-2-phenylmethoxybenzamide.
| Compound Name | 3-amino-N-[4-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 163587065 |
| Molecular Formula | C30H23FN4O4 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 3-amino-N-[4-(5-fluoro-6-phenoxypyrimidin-4-yl)oxyphenyl]-2-phenylmethoxybenzamide |
| SMILES | Nc1cccc(C(=O)Nc2ccc(Oc3ncnc(Oc4ccccc4)c3F)cc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C30H23FN4O4/c31-26-29(38-22-10-5-2-6-11-22)33-19-34-30(26)39-23-16-14-21(15-17-23)35-28(36)24-12-7-13-25(32)27(24)37-18-20-8-3-1-4-9-20/h1-17,19H,18,32H2,(H,35,36) |
| InChIKey | GMJGXNNHBMSDJL-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|