C18H21N3O2 — CID 163587116
(Z)-N-[[6-(3,4-dimethoxyphenyl)-3-pyridinyl]methyl]-N-methyl-2-(methylideneamino)ethenamine (PubChem CID 163587116) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (Z)-N-[[6-(3,4-dimethoxyphenyl)-3-pyridinyl]methyl]-N-methyl-2-(methylideneamino)ethenamine.
| Compound Name | (Z)-N-[[6-(3,4-dimethoxyphenyl)-3-pyridinyl]methyl]-N-methyl-2-(methylideneamino)ethenamine |
|---|---|
| PubChem CID | 163587116 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (Z)-N-[[6-(3,4-dimethoxyphenyl)-3-pyridinyl]methyl]-N-methyl-2-(methylideneamino)ethenamine |
| SMILES | C=N/C=C\N(C)Cc1ccc(-c2ccc(OC)c(OC)c2)nc1 |
| InChI | InChI=1S/C18H21N3O2/c1-19-9-10-21(2)13-14-5-7-16(20-12-14)15-6-8-17(22-3)18(11-15)23-4/h5-12H,1,13H2,2-4H3/b10-9- |
| InChIKey | GMKGLZZJLQSWBB-KTKRTIGZSA-N |
| XLogP | 3.37 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|