C20H17BrFN3O3S — CID 163587968
(2R,3Z)-2-(5-bromo-3-oxo-1H-isoindol-2-yl)-5-fluoro-3-(1-methoxyethenyl)-N-(1,3-thiazol-2-yl)hexa-3,5-dienamide (PubChem CID 163587968) has the molecular formula C20H17BrFN3O3S and a molecular weight of 478.34 g/mol. Its IUPAC name is (2R,3Z)-2-(5-bromo-3-oxo-1H-isoindol-2-yl)-5-fluoro-3-(1-methoxyethenyl)-N-(1,3-thiazol-2-yl)hexa-3,5-dienamide.
| Compound Name | (2R,3Z)-2-(5-bromo-3-oxo-1H-isoindol-2-yl)-5-fluoro-3-(1-methoxyethenyl)-N-(1,3-thiazol-2-yl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 163587968 |
| Molecular Formula | C20H17BrFN3O3S |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | (2R,3Z)-2-(5-bromo-3-oxo-1H-isoindol-2-yl)-5-fluoro-3-(1-methoxyethenyl)-N-(1,3-thiazol-2-yl)hexa-3,5-dienamide |
| SMILES | C=C(F)/C=C(\C(=C)OC)[C@H](C(=O)Nc1nccs1)N1Cc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C20H17BrFN3O3S/c1-11(22)8-15(12(2)28-3)17(18(26)24-20-23-6-7-29-20)25-10-13-4-5-14(21)9-16(13)19(25)27/h4-9,17H,1-2,10H2,3H3,(H,23,24,26)/b15-8+/t17-/m1/s1 |
| InChIKey | GNCGDIBWYFFIOO-YBYKNVHQSA-N |
| XLogP | 4.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|