C13H18 — CID 163588261
9-methylpentacyclo[6.2.1.13,6.01,9.02,7]dodecane (PubChem CID 163588261) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 9-methylpentacyclo[6.2.1.13,6.01,9.02,7]dodecane.
| Compound Name | 9-methylpentacyclo[6.2.1.13,6.01,9.02,7]dodecane |
|---|---|
| PubChem CID | 163588261 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 9-methylpentacyclo[6.2.1.13,6.01,9.02,7]dodecane |
| SMILES | CC12CC13CC2C1C2CCC(C2)C13 |
| InChI | InChI=1S/C13H18/c1-12-6-13(12)5-9(12)10-7-2-3-8(4-7)11(10)13/h7-11H,2-6H2,1H3 |
| InChIKey | GNIKZORYMZHYQG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |