C22H24F3N4O4P — CID 163592646
6-dimethylphosphoryl-7-methoxy-2-methyl-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 163592646) has the molecular formula C22H24F3N4O4P and a molecular weight of 496.43 g/mol. Its IUPAC name is 6-dimethylphosphoryl-7-methoxy-2-methyl-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 6-dimethylphosphoryl-7-methoxy-2-methyl-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 163592646 |
| Molecular Formula | C22H24F3N4O4P |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 6-dimethylphosphoryl-7-methoxy-2-methyl-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3C)c2cc1P(C)(C)=O |
| InChI | InChI=1S/C22H24F3N4O4P/c1-11-15(7-14(29(30)31)8-17(11)22(23,24)25)12(2)26-21-16-9-20(34(5,6)32)19(33-4)10-18(16)27-13(3)28-21/h7-10,12H,1-6H3,(H,26,27,28)/t12-/m1/s1 |
| InChIKey | GQUCUPYSZWOUBO-GFCCVEGCSA-N |
| XLogP | 5.60 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|