C13H25NO2S — CID 163592778
N-[(6Z,8Z)-4-methylundeca-6,8-dien-2-yl]methanesulfonamide (PubChem CID 163592778) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is N-[(6Z,8Z)-4-methylundeca-6,8-dien-2-yl]methanesulfonamide.
| Compound Name | N-[(6Z,8Z)-4-methylundeca-6,8-dien-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 163592778 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-[(6Z,8Z)-4-methylundeca-6,8-dien-2-yl]methanesulfonamide |
| SMILES | CC/C=C\C=C/CC(C)CC(C)NS(C)(=O)=O |
| InChI | InChI=1S/C13H25NO2S/c1-5-6-7-8-9-10-12(2)11-13(3)14-17(4,15)16/h6-9,12-14H,5,10-11H2,1-4H3/b7-6-,9-8- |
| InChIKey | GQWQCPYIJYDBKB-JPDBVBESSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|