C16H31NO2S — CID 143225625
ethane;(2Z,4E)-N-(4-methylcyclohexyl)hepta-2,4-diene-4-sulfonamide (PubChem CID 143225625) has the molecular formula C16H31NO2S and a molecular weight of 301.50 g/mol. Its IUPAC name is ethane;(2Z,4E)-N-(4-methylcyclohexyl)hepta-2,4-diene-4-sulfonamide.
| Compound Name | ethane;(2Z,4E)-N-(4-methylcyclohexyl)hepta-2,4-diene-4-sulfonamide |
|---|---|
| PubChem CID | 143225625 |
| Molecular Formula | C16H31NO2S |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | ethane;(2Z,4E)-N-(4-methylcyclohexyl)hepta-2,4-diene-4-sulfonamide |
| SMILES | C/C=C\C(=C/CC)S(=O)(=O)NC1CCC(C)CC1.CC |
| InChI | InChI=1S/C14H25NO2S.C2H6/c1-4-6-14(7-5-2)18(16,17)15-13-10-8-12(3)9-11-13;1-2/h4,6-7,12-13,15H,5,8-11H2,1-3H3;1-2H3/b6-4-,14-7+; |
| InChIKey | JYFBOVUXLAUWFL-JQCDVGGOSA-N |
| XLogP | 4.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|