C14H25NO2S — CID 143113200
(3E,5Z)-N-cyclohexylocta-3,5-diene-4-sulfonamide (PubChem CID 143113200) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is (3E,5Z)-N-cyclohexylocta-3,5-diene-4-sulfonamide.
| Compound Name | (3E,5Z)-N-cyclohexylocta-3,5-diene-4-sulfonamide |
|---|---|
| PubChem CID | 143113200 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (3E,5Z)-N-cyclohexylocta-3,5-diene-4-sulfonamide |
| SMILES | CC/C=C\C(=C/CC)S(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H25NO2S/c1-3-5-12-14(9-4-2)18(16,17)15-13-10-7-6-8-11-13/h5,9,12-13,15H,3-4,6-8,10-11H2,1-2H3/b12-5-,14-9+ |
| InChIKey | AAVYGBSNFLPURM-FTPHHNMSSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|