C10H17NO2S — CID 163971904
2-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 163971904) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 2-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 163971904 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CC1=C(S(=O)(=O)NC(C)C)C=CCC1 |
| InChI | InChI=1S/C10H17NO2S/c1-8(2)11-14(12,13)10-7-5-4-6-9(10)3/h5,7-8,11H,4,6H2,1-3H3 |
| InChIKey | SQSAVSLWXHRSAA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |